Korean, Edit

Collection of Python Functions for Organic Chemistry (Chemoinformatics; Structural Bioinformatics)

Recommended posts: 【Organic Chemistry】 Organic Chemistry Index, 【Python】 Collection of Useful Python Functions 


1. Nomenclature

2. Drawing

3. Amino Acid

4. Spectroscopy

5. Reaction Mechanism


a. Bioinformatics



1. Nomenclature 

SMILES (Simplified Molecular-Input Line Entry System): A short ASCII string representation.

① Double bonds are represented by ‘=’, and triple bonds by ‘#’.

② For cyclic compounds, numbers such as 1, 2, … are assigned to indicate that the ends of a linear molecule are connected to form a ring.

○ Example: CN1C=NC2=C1C(=O)N(C(=O)N2C)C

③ ‘C’ represents a general carbon atom, whereas ‘c’ represents an aromatic carbon atom.

○ C1CCCCC1: Cyclohexane

○ c1ccccc1: Benzene

④ Parentheses can be used to indicate more complex cases.

○ Charge notation can also be indicated, such as [N+].

⑤ @ symbol can be used to represent a stereocenter in a molecule.

○ Example: CC@HC@HC

⑥ / and \ symbols can be used to represent E/Z isomers.

○ Example: CCC/C(=C/C(=O)OCC)/C(=O)OCC

⑵ Code for converting organic compounds into SMILES


rdkit.Chem.MolToSmiles(Chem.MolFromFASTA(sequence, flavor = 1))

"""
flavor: (optional)
0 Protein, L amino acids (default)
1 Protein, D amino acids
2 RNA, no cap
3 RNA, 5’ cap
4 RNA, 3’ cap
5 RNA, both caps
6 DNA, no cap
7 DNA, 5’ cap
8 DNA, 3’ cap
9 DNA, both caps
"""


⑶ SMILES, IUPAC Interconversion Code : It uses a transformer model.


# reference: https://github.com/Kohulan/Smiles-TO-iUpac-Translator

! pip install STOUT-pypi
! pip install git+https://github.com/Kohulan/Smiles-TO-iUpac-Translator.git

from STOUT import translate_forward, translate_reverse

# SMILES to IUPAC name translation

SMILES = "CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
IUPAC_name = translate_forward(SMILES)
print("IUPAC name of "+SMILES+" is: "+IUPAC_name)

# IUPAC name to SMILES translation

IUPAC_name = "1,3,7-trimethylpurine-2,6-dione"
SMILES = translate_reverse(IUPAC_name)
print("SMILES of "+IUPAC_name+" is: "+SMILES)


① SMILES code conversion may work even if the IUPAC input is not completely accurate

⑷ How to find out the IUPAC nomenclature given any chemical formula

Step 1. Try the SMILES-to-drawing function several times to find the SMILES code representing the given compound.

Step 2. Execute the SMILES-to-IUPAC function to obtain the final nomenclature.



⑸ Code for obtaining molecular weight from SMILES


from rdkit import Chem
from rdkit.Chem import Descriptors

def calculate_molecular_weight(smiles):
    molecule = Chem.MolFromSmiles(smiles)
    return Descriptors.ExactMolWt(molecule)

# Example usage
smiles_code = "C1=CC=C(C=C1)O"  # SMILES code for phenol
molecular_weight = calculate_molecular_weight(smiles_code)
print(f"Molecular Weight: {molecular_weight}")


⑹ Code to determine aromaticity from SMILES


from rdkit import Chem

def is_aromatic(smiles):
    molecule = Chem.MolFromSmiles(smiles)
    if molecule is None:
        return False
    return any(atom.GetIsAromatic() for atom in molecule.GetAtoms())

# Example usage
cyclohexane = "C1CCCCC1"  # cyclohexane
benzene = "c1ccccc1"  # benzene
imidazole = "C1=CN=CN1" # 1H-imidazole

print(f"The {cyclohexane} is {'aromatic' if is_aromatic(cyclohexane) else 'not aromatic'}")
print(f"The {benzene} is {'aromatic' if is_aromatic(benzene) else 'not aromatic'}")
print(f"The {imidazole} is {'aromatic' if is_aromatic(imidazole) else 'not aromatic'}")


⑺ Code for calculating dipole moment from SMILES


# conda install -c psi4 psi4

import psi4
from rdkit import Chem
from rdkit.Chem import AllChem
import numpy as np

def calculate_dipole_moment(smiles):
    # Convert SMILES to molecule
    mol = Chem.MolFromSmiles(smiles)

    # Add Hydrogens
    mol = Chem.AddHs(mol)

    # Generate 3D coordinates
    AllChem.EmbedMolecule(mol, AllChem.ETKDG())

    # Extract coordinates
    conf = mol.GetConformer()
    xyz = ''
    for atom in mol.GetAtoms():
        pos = conf.GetAtomPosition(atom.GetIdx())
        xyz += f"{atom.GetSymbol()} {pos.x} {pos.y} {pos.z}\n"

    # Set up Psi4
    psi4.set_memory('500 MB')
    psi4.set_options({'basis': 'sto-3g'})

    # Calculate dipole moment using Psi4
    psi4_mol = psi4.geometry(xyz)
    psi4.energy('scf')
    dipole_moment = psi4.variable('SCF DIPOLE')

    return dipole_moment

### Example usage
smiles_code = "CCO"  # Example SMILES code for ethanol
dipole_moment = calculate_dipole_moment(smiles_code)
print(f"Dipole Moment: {dipole_moment} Debye")
# Dipole Moment: [ 0.04250251  0.20600936 -0.52850913] Debye

dipole_vector = np.array([0.04250251, 0.20600936, -0.52850913])
magnitude = np.linalg.norm(dipole_vector)
print(f"Magnitude of Dipole Moment: {magnitude} Debye")
# Magnitude of Dipole Moment: 0.5688305725409514 Debye


⑻ A function to obtain the boiling point (bp), melting point (mp), and critical temperature from SMILES


# reference: https://thermo.readthedocs.io/thermo.chemical.html

from thermo.chemical import Chemical

N2 = Chemical('Nitrogen')
print(N2.Tm, N2.Tb, N2.Tc) # melting, boiling, and critical points [K]
## 63.15 77.3549950205 126.192

molecule = Chemical('CC(C)C')
print(molecule.Tm, molecule.Tb, molecule.Tc) # melting, boiling, and critical points [K]
## 124.2 261.401014643 407.81

molecule_ = Chemical('2-methylpropane')
print(molecule_.Tm, molecule_.Tb, molecule_.Tc) # melting, boiling, and critical points [K]
## 124.2 261.401014643 407.81


① It operates on a search-based approach and not all compounds are targeted.

② Various machine learning models are being introduced to improve this.

⑼ Model for predicting ADMET (Absorption, Distribution, Metabolism, Excretion, Toxicity) from SMILES : ADMET-AI

⑽ Function to generate IUPAC names from PubChem


import requests
import time

def fetch_iupac_names_from_pubchem(start_cid, count):
    iupac_names = []
    base_url = "https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/{}/property/IUPACName/JSON"
    
    current_cid = start_cid
    while len(iupac_names) < count:
        response = requests.get(base_url.format(current_cid))
        if response.status_code == 200:
            data = response.json()
            if 'PropertyTable' in data and 'Properties' in data['PropertyTable']:
                for prop in data['PropertyTable']['Properties']:
                    if 'IUPACName' in prop:
                        iupac_names.append(prop['IUPACName'])
                        if len(iupac_names) >= count:
                            break
        else:
            print(f"Failed to fetch data for CID {current_cid}")
        
        current_cid += 1
        time.sleep(0.1)  # To prevent hitting the API rate limit

    return iupac_names

# Fetch 100 IUPAC names starting from CID 1
iupac_names = fetch_iupac_names_from_pubchem(start_cid=1, count=100)


Application 1. Creating IUPAC Nomenclature Examples

○ Crawling IUPAC nomenclature from PubChem → IUPAC-to-SMILES → SMILES-to-image

○ The example generation algorithm includes an additional step of verifying if SMILES-to-IUPAC matches the original IUPAC, which results in the following incidental effects:

Effect 1. Exclusion of inappropriate IUPAC nomenclature

Effect 2. By eliminating nomenclature that is difficult for computers to understand, the complexity of the nomenclature examples is adjusted.


⑾ Function to generate SMILES names with stereochemistry from PubChem


import requests
import time
from rdkit import Chem
from rdkit.Chem import AllChem
from rdkit.Chem.EnumerateStereoisomers import EnumerateStereoisomers, StereoEnumerationOptions

def fetch_smiles_from_pubchem(start_cid, count):
    smiles_list = []
    base_url = "https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/{}/property/CanonicalSMILES/JSON"
    
    current_cid = start_cid
    while len(smiles_list) < count:
        response = requests.get(base_url.format(current_cid))
        if response.status_code == 200:
            data = response.json()
            if 'PropertyTable' in data and 'Properties' in data['PropertyTable']:
                for prop in data['PropertyTable']['Properties']:
                    if 'CanonicalSMILES' in prop:
                        smiles_list.append(prop['CanonicalSMILES'])
                        if len(smiles_list) >= count:
                            break
        else:
            print(f"Failed to fetch data for CID {current_cid}")
        
        current_cid += 1
        time.sleep(0.1)  # To prevent hitting the API rate limit

    return smiles_list

def generate_stereoisomers(smiles, max_isomers=5):
    mol = Chem.MolFromSmiles(smiles)
    if mol is None:
        return []
    
    opts = StereoEnumerationOptions(onlyUnassigned=True, maxIsomers=max_isomers)
    isomers = list(EnumerateStereoisomers(mol, options=opts))
    
    smiles_isomers = [Chem.MolToSmiles(isomer, isomericSmiles=True) for isomer in isomers]
    return smiles_isomers

# Fetch 100 canonical SMILES codes starting from CID 1
smiles_codes = fetch_smiles_from_pubchem(start_cid=1, count=100)

# Generate stereoisomers for each fetched SMILES code
all_stereoisomers = []
for i, smiles in enumerate(smiles_codes, start=1):
    stereoisomers = generate_stereoisomers(smiles)
    all_stereoisomers.extend(stereoisomers)
    print(f"Canonical SMILES {i}: {smiles}")
    for j, isomer in enumerate(stereoisomers, start=1):
        print(f"  Stereoisomer {j}: {isomer}")

# Optionally, limit the number of generated stereoisomers for display
max_display = 100
print("\nGenerated Stereoisomers (limited to first {}):".format(max_display))
for i, isomer in enumerate(all_stereoisomers[:max_display], start=1):
    print(f"{i}: {isomer}")
    

''' Visualization code example
from rdkit import Chem
from rdkit.Chem import Draw

smiles = 'O=C(O)C[C@@]1(Cl)C=CC(=O)O1'
molecule = Chem.MolFromSmiles(smiles)
Draw.MolToImage(molecule)
'''


Application 1. Creating RS Nomenclature Examples

○ CrawlingSMILES nomenclature from PubChem → canonical SMILES to stereochemical SMILES → SMILES-to-image

Application 2. The above code yields a structure that particularly favors the R configuration.

○ In practice, upon examining 62 examples of stereoisomers, 40 instances favored the R configuration while 22 favored the S configuration, indicating a preference for the R configuration in the test.

○ The theoretical ratio of R isomers and S isomers should be identical, so it is suspected that there might be a cognitive bias instead.



2. Drawing 

⑴ Drawing molecular formulas for organic compounds (e.g., peracetic acid) 


from rdkit import Chem
from rdkit.Chem import Draw

# Define the SMILES strings for peracetic acid
smiles = 'C=CC(=O)O'

# Convert the SMILES strings to RDKit molecule objects
molecule = Chem.MolFromSmiles(smiles)

# Draw the molecules without saving
Draw.MolToImage(molecule)

# Draw the molecules with saving
Draw.MolToFile(molecule, 'peracetic_acid.png')


image


⑵ Drawing electron density maps for organic compounds (ver. 1) (e.g., peracetic acid)


from rdkit import Chem
from rdkit.Chem import AllChem
from rdkit.Chem.Draw import SimilarityMaps

# Generate a 3D structure
molecule = Chem.MolFromSmiles('CC(=O)OO')
molecule_3d = Chem.AddHs(molecule)
AllChem.EmbedMolecule(molecule_3d, AllChem.ETKDG())
AllChem.MMFFOptimizeMolecule(molecule_3d)

# Calculate Gasteiger charges
AllChem.ComputeGasteigerCharges(molecule_3d)

# Function to get atom charges
def GetAtomCharges(mol):
    charges = [float(mol.GetAtomWithIdx(i).GetProp('_GasteigerCharge')) for i in range(mol.GetNumAtoms())]
    return charges

# Draw electrostatic potential map
fig = SimilarityMaps.GetSimilarityMapFromWeights(molecule_3d, GetAtomCharges(molecule_3d), colorMap='jet', contourLines=10)


image


⑶ Drawing electron density maps for organic compounds (ver. 2) (e.g., peracetic acid)


# Refernece: https://rdkit.readthedocs.io/en/latest/Cookbook.html


## STEP 1. make a random forest model

from rdkit import Chem, DataStructs
from rdkit.Chem import AllChem
from sklearn.ensemble import RandomForestClassifier
import numpy

# generate four molecules
m1 = Chem.MolFromSmiles('c1ccccc1')
m2 = Chem.MolFromSmiles('c1ccccc1CC')
m3 = Chem.MolFromSmiles('c1ccncc1')
m4 = Chem.MolFromSmiles('c1ccncc1CC')
mols = [m1, m2, m3, m4]

# generate fingeprints: Morgan fingerprint with radius 2
fps = [AllChem.GetMorganFingerprintAsBitVect(m, 2) for m in mols]

# convert the RDKit explicit vectors into numpy arrays
np_fps = []
for fp in fps:
  arr = numpy.zeros((1,))
  DataStructs.ConvertToNumpyArray(fp, arr)
  np_fps.append(arr)

# get a random forest classifiert with 100 trees
rf = RandomForestClassifier(n_estimators=100, random_state=1123)

# train the random forest
# with the first two molecules being actives (class 1) and
# the last two being inactives (class 0)
ys_fit = [1, 1, 0, 0]
rf.fit(np_fps, ys_fit)

# use the random forest to predict a new molecule
m5 = Chem.MolFromSmiles('c1ccccc1O')
fp = numpy.zeros((1,))
DataStructs.ConvertToNumpyArray(AllChem.GetMorganFingerprintAsBitVect(m5, 2), fp)

print(rf.predict((fp,)))
print(rf.predict_proba((fp,)))



## STEP 2. run the random forest model for the input

from rdkit.Chem.Draw import SimilarityMaps

# helper function
def getProba(fp, predictionFunction):
  return predictionFunction((fp,))[0][1]

m5 = Chem.MolFromSmiles('CC(=O)OO')
fig, maxweight = SimilarityMaps.GetSimilarityMapForModel(m5, SimilarityMaps.GetMorganFingerprint, lambda x: getProba(x, rf.predict_proba))


image


⑷ Drawing three-dimensional molecular structures of organic compounds.


from rdkit import Chem
from rdkit.Chem import AllChem
import py3Dmol

def draw_3d_molecule(smiles):
    # Convert SMILES to RDKit molecule
    mol = Chem.MolFromSmiles(smiles)
    if mol is None:
        print("Invalid SMILES code.")
        return
    
    # Generate 3D coordinates for the molecule
    mol = Chem.AddHs(mol)  # Add hydrogens
    AllChem.EmbedMolecule(mol, AllChem.ETKDG())  # Embed molecule in 3D space
    
    # Convert RDKit molecule to 3Dmol.js viewable format
    mb = Chem.MolToMolBlock(mol)
    
    # Visualization with Py3Dmol
    viewer = py3Dmol.view(width=400, height=300)
    viewer.addModel(mb, 'mol')
    viewer.setStyle({'stick': {}})
    viewer.zoomTo()
    
    return viewer.show()

# Example usage
smiles_code = "CCO"  # Ethanol
draw_3d_molecule(smiles_code)


Review 1: In methanol, the two methyl groups are in a staggered orientation to minimize steric hindrance, whereas in ethanol, this is not the case due to intramolecular hydrogen bonding.


스크린샷 2024-06-11 오후 12 34 59


Review 2: The structure is also well implemented in the following conjugated ring compounds.


스크린샷 2024-06-11 오후 12 34 31


③ This is the charm of chemoinformatics, where new knowledge can be created solely with machine learning models.

⑸ Displaying 2D molecular structure with R/S nomenclature for organic compounds


from rdkit import Chem
from rdkit.Chem import AllChem, Draw
from rdkit.Chem.rdMolDescriptors import CalcMolFormula
from PIL import Image, ImageDraw, ImageFont
import matplotlib.font_manager as fm

def get_stereochemistry(mol):
    Chem.AssignStereochemistry(mol, cleanIt=True, force=True)
    stereo_info = {}
    for atom in mol.GetAtoms():
        if atom.HasProp('_CIPCode'):
            stereo_info[atom.GetIdx()] = atom.GetProp('_CIPCode')
    return stereo_info

def draw_2d_molecule_with_stereochemistry(smiles, filename="molecule.png"):
    # Convert SMILES to RDKit molecule
    mol = Chem.MolFromSmiles(smiles)
    if mol is None:
        print("Invalid SMILES code.")
        return
    
    # Generate 2D coordinates for the molecule
    AllChem.Compute2DCoords(mol)
    
    # Get stereochemistry information
    stereo_info = get_stereochemistry(mol)
    print(stereo_info)
    
    # Draw the molecule
    img = Draw.MolToImage(mol, size=(300, 300), kekulize=True, wedgeBonds=True)
    
    # Convert the RDKit image to a PIL image
    pil_img = img.convert("RGBA")
    
    # Create a drawing context
    draw = ImageDraw.Draw(pil_img)
    
    # Load fonts
    font_size = 18  # You can change the font size here
    try:
        # Use DejaVuSans.ttf for regular text
        font_path = fm.findfont(fm.FontProperties(family="DejaVu Sans"))
        font = ImageFont.truetype(font_path, font_size)
        # Use DejaVuSans-Oblique.ttf for italic text
        italic_font_path = fm.findfont(fm.FontProperties(family="DejaVu Sans", style="italic"))
        italic_font = ImageFont.truetype(italic_font_path, font_size)
    except IOError:
        font = ImageFont.load_default()
        italic_font = font  # Fallback if no italic font is found
    
    # Generate 2D coordinates for the drawing
    AllChem.Compute2DCoords(mol)
    conf = mol.GetConformer()
    
    # Get 2D coordinates for each atom
    coords = conf.GetPositions()
    
    # Add stereo annotations
    for atom_idx, stereo in stereo_info.items():
        atom = mol.GetAtomWithIdx(atom_idx)
        pos = coords[atom_idx]
        
        # Calculate pixel position from molecule coordinates
        x = pos[0] * 35 + 135
        y = -pos[1] * 35 + 150
        
        # Draw the text annotation with non-italicized brackets and italicized R/S
        draw.text((x, y), "(", fill=(0, 0, 0), font=font)
        draw.text((x + 10, y), stereo, fill=(0, 0, 0), font=italic_font)
        draw.text((x + 30, y), ")", fill=(0, 0, 0), font=font)
    
    # Save the image to a file
    pil_img.save(filename)
    print(f"Image saved as {filename}")

# Example usage
smiles_code = "C[C@H](O)[C@H](O)C"  # Example molecule with stereochemistry
draw_2d_molecule_with_stereochemistry(smiles_code, "molecule_with_stereochemistry.png")


image


⑹ Displaying 3D molecular structure with R/S nomenclature for organic compounds


from rdkit import Chem
from rdkit.Chem import AllChem, Draw
from rdkit.Chem.rdMolDescriptors import CalcMolFormula
import py3Dmol

def get_stereochemistry(mol):
    Chem.AssignStereochemistry(mol, cleanIt=True, force=True)
    stereo_info = {}
    for atom in mol.GetAtoms():
        if atom.HasProp('_CIPCode'):
            stereo_info[atom.GetIdx()] = atom.GetProp('_CIPCode')
    return stereo_info

def draw_3d_molecule_with_stereochemistry(smiles):
    # Convert SMILES to RDKit molecule
    mol = Chem.MolFromSmiles(smiles)
    if mol is None:
        print("Invalid SMILES code.")
        return
    
    # Generate 3D coordinates for the molecule
    mol = Chem.AddHs(mol)  # Add hydrogens
    AllChem.EmbedMolecule(mol, AllChem.ETKDG())  # Embed molecule in 3D space
    
    # Get stereochemistry information
    stereo_info = get_stereochemistry(mol)
    print(stereo_info)
    
    # Convert RDKit molecule to 3Dmol.js viewable format
    mb = Chem.MolToMolBlock(mol)
    
    # Visualization with Py3Dmol
    viewer = py3Dmol.view(width=400, height=300)
    viewer.addModel(mb, 'mol')
    viewer.setStyle({'stick': {}})
    
    # Annotate the stereochemistry on the molecule
    for atom_idx, stereo in stereo_info.items():
        pos = mol.GetConformer().GetAtomPosition(atom_idx)
        viewer.addLabel(stereo, {
            'position': {'x': pos.x, 'y': pos.y, 'z': pos.z}, 
            'backgroundColor': 'black', 
            'fontColor': 'white', 
            'fontSize': 14, 
            'showBackground': True
        })
    
    viewer.zoomTo()
    
    return viewer.show()

# Example usage
smiles_code = "C[C@H](O)[C@H](O)C"  # Example molecule with stereochemistry
draw_3d_molecule_with_stereochemistry(smiles_code)


스크린샷 2024-06-11 오후 12 35 18


⑺ Code that draws all of the structural isomers of alkanes according to the number of carbon atoms


from rdkit import Chem
from rdkit.Chem import Draw
from rdkit.Chem import AllChem
from rdkit.Chem.rdchem import Mol
from IPython.display import display

def generate_alkanes(n_carbons):
    if n_carbons == 1:
        return [Chem.MolFromSmiles('C')]
    elif n_carbons == 2:
        return [Chem.MolFromSmiles('CC')]
    
    smaller_alkanes = generate_alkanes(n_carbons - 1)
    new_alkanes = set()
    
    for mol in smaller_alkanes:
        for atom in mol.GetAtoms():
            if atom.GetDegree() < 4:  # Carbon can have at most four bondings 
                new_mol = Chem.RWMol(mol)
                new_idx = new_mol.AddAtom(Chem.Atom(6))
                new_mol.AddBond(atom.GetIdx(), new_idx, Chem.BondType.SINGLE)
                Chem.SanitizeMol(new_mol)
                smiles = Chem.MolToSmiles(new_mol, canonical=True)
                new_alkanes.add(smiles)
    
    return [Chem.MolFromSmiles(smiles) for smiles in new_alkanes]

# Generation and Visualization of All Structural Isomers of C7H16 
n_carbons = 7
alkanes = generate_alkanes(n_carbons)
img = Draw.MolsToGridImage(alkanes, molsPerRow=5, subImgSize=(200, 200))

# Directly display images (works only in Jupyter notebooks)
display(img)


image


Chemical Formula # of Structural Isomers
C3H8 1
C4H10 2
C5H12 3
C6H14 5
C7H16 9
C8H18 18
C9H20 35
C10H22 75
C11H24 159
C12H26 355
C13H28 802
C14H30 1,858
C15H32 4,347
C16H34 10,359
C17H36 24,894
C18H38 60,523
C19H40 148,284
C20H42 366,319
C30H62 4,111,846,763
C40H82 62,481,801,147,341


Table 1. Number of structural isomers of alkanes based on carbon count


The structural isomers of alkane and recurrence relation

⑻ Code to Draw All Alkane Substituents Using a Tree Data Structure (Duplicates exist starting from n_carbons = 6)


from rdkit import Chem
from rdkit.Chem import Draw
from rdkit.Chem.rdchem import AtomValenceException
from IPython.display import display

class Node:
    def __init__(self, id):
        self.id = id
        self.children = []

class Tree:
    def __init__(self, root):
        self.nodes = [root]

    def add_node(self, parent_id, node_id, max_nodes):
        if len(self.nodes) >= max_nodes or len(self.nodes[parent_id].children) >= 3:
            return None
        new_node = Node(node_id)
        self.nodes.append(new_node)
        self.nodes[parent_id].children.append(new_node)
        return new_node

def generate_trees(current_tree, current_id, max_nodes):
    if len(current_tree.nodes) == max_nodes:
        if is_valid_tree(current_tree):
            return [current_tree]
        else:
            return []
    
    trees = []
    for node_id in range(len(current_tree.nodes)):
        new_tree = Tree(Node(0))
        new_tree.nodes = [Node(i) for i in range(len(current_tree.nodes))]
        for i in range(len(current_tree.nodes)):
            new_tree.nodes[i].children = [new_tree.nodes[n.id] for n in current_tree.nodes[i].children]

        new_node = new_tree.add_node(node_id, current_id, max_nodes)
        if new_node and is_valid_tree(new_tree):
            trees.extend(generate_trees(new_tree, current_id + 1, max_nodes))
    return trees

def is_valid_tree(tree):
    for node in tree.nodes:
        children_counts = [len(child.children) for child in node.children]
        if any(children_counts[i] > children_counts[i+1] for i in range(len(children_counts)-1)):
            return False
    return True

def visualize_organic_structures(trees):
    mols = []
    for tree in trees:
        mol = Chem.RWMol()
        atom_index = {}
        for node in tree.nodes:
            if node.id == 0:
                atom = Chem.Atom(6)
                atom.SetNumRadicalElectrons(1)  # Set radical electron for the root
            else:
                atom = Chem.Atom(6)
            atom_index[node.id] = mol.AddAtom(atom)
        for node in tree.nodes:
            for child in node.children:
                mol.AddBond(atom_index[node.id], atom_index[child.id], Chem.BondType.SINGLE)
        mols.append(mol)
    return mols

# Input the total number of nodes
n_nodes = 4

# Start with a single root node
initial_tree = Tree(Node(0))
all_trees = generate_trees(initial_tree, 1, n_nodes)
all_mols = visualize_organic_structures(all_trees)

# Visualization
img = Draw.MolsToGridImage(all_mols, molsPerRow=5, subImgSize=(200, 200), useSVG=False)
display(img)


n_carbons = 3: Total 2 sets


image


n_carbons = 4: Total 4 sets


image


n_carbons = 5: Total 8 sets


image


n_carbons = 6: Total 17 sets


image



3. Amino Acid

⑴ A function of converting a sequence into an amino acid sequence


from Bio.Seq import Seq

# Assuming 'sequence' is your string of nucleotides:
sequence = "ACTCATTCTCCCCAGACGCCAAGGATGGTGGTCATGGCGCCCCGAACCCTCTTCCTGCTGCTCTCGGGGGCCCTGACCCTGACCGAGACCTGGGCGG"  # truncated for brevity

# Create a sequence object
seq_obj = Seq(sequence)

# Translate the sequence
amino_acid_sequence = seq_obj.translate(to_stop=True)

# Print the amino acid sequence
print(amino_acid_sequence)


⑵ Function to convert gene names into amino acid sequences


!git clone https://github.com/deepmind/alphafold.git
!cd alphafold/scripts
!sudo apt install aria2
!bash download_uniprot.sh ./

from pathlib import Path

def extract_sequences_from_uniprot(uniprot_fasta_path, gene_list, output_path="selected_genes.fa"):
    """
    Extract the protein sequence of the gene contained in gene_list from the UniProt FASTA file and save it as a .fa file
    """
    result = []
    current_header = ""
    current_seq = []
    include = False
    gene_set = set(g.upper() for g in gene_list)

    with open(uniprot_fasta_path, 'r') as f:
        for line in f:
            if line.startswith('>'):
                if include and current_header and current_seq:
                    result.append((gene_name, ''.join(current_seq)))
                # Start a new sequence
                current_header = line.strip()
                current_seq = []
                include = False
                # Extract the gene name from the header
                if 'GN=' in current_header:
                    try:
                        gene_name = current_header.split('GN=')[1].split()[0].upper()
                        if gene_name in gene_set:
                            include = True
                    except Exception:
                        pass
            else:
                if include:
                    current_seq.append(line.strip())

        # Add the last sequence
        if include and current_header and current_seq:
            result.append((gene_name, ''.join(current_seq)))

    # Save
    if result:
        with open(output_path, 'w') as f:
            for gene, seq in result:
                f.write(f">{gene}\n{seq}\n")
        print(f"✅ {len(result)} sequences saved in '{output_path}'")
    else:
        print("❌ The sequence of this gene could not be found.")
        
# 🔧 Execute an example
gene_list = ['THBS4', 'CD36']
uniprot_fasta_path = "uniprot.fasta"
extract_sequences_from_uniprot(uniprot_fasta_path, gene_list, output_path="genes_from_local_uniprot.fa")

# ✅ 1312 sequences were stored in 'genes_from_local_uniprot.fa'.


⑶ Function to generate PDB files regarding amino acid structure from amino acid sequence using AlphaFold2

① Installing AlphaFold2


git clone https://github.com/deepmind/alphafold.git
cd alphafold/scripts
sudo apt install aria2

bash download_all_data.sh ./ 
docker build -f docker/Dockerfile -t alphafold . 

docker run --gpus all -it \
  --name alphafold_cpu_session \
  -v "$(pwd)":/app/alphafold \
  -v "$(pwd)/afdb":/mnt/databases \
  -v "$(pwd)/output":/mnt/output \
  --entrypoint /bin/bash \
  alphafold

#docker start -ai alphafold_cpu_session
#docker exec -it alphafold_cpu_session bash
#docker stop alphafold_cpu_session
#docker rm alphafold_cpu_session


② Run AlphaFold 2 Monomer


#export TF_FORCE_UNIFIED_MEMORY=1           ## for GPU
#export XLA_PYTHON_CLIENT_PREALLOCATE=false ## for GPU
#export XLA_PYTHON_CLIENT_MEM_FRACTION=.85  ## for GPU

export JAX_PLATFORM_NAME=cpu                ## for CPU
export JAX_TRACEBACK_FILTERING=off          ## for CPU

python3 /app/alphafold/run_alphafold.py \
  --fasta_paths=/app/alphafold/data/data.fa \
  --output_dir=/mnt/output \
  --data_dir=/app/alphafold/scripts \
  --model_preset=monomer \
  --db_preset=reduced_dbs \
  --uniref90_database_path=/app/alphafold/scripts/uniref90/uniref90.fasta \
  --mgnify_database_path=/app/alphafold/scripts/mgnify/mgy_clusters_2022_05.fa \
  --small_bfd_database_path=/app/alphafold/scripts/small_bfd/bfd-first_non_consensus_sequences.fasta \
  --pdb70_database_path=/app/alphafold/scripts/pdb70/pdb70 \
  --template_mmcif_dir=/app/alphafold/scripts/pdb_mmcif/mmcif_files \
  --obsolete_pdbs_path=/app/alphafold/scripts/pdb_mmcif/obsolete.dat \
  --max_template_date=2023-12-31 \
  --use_gpu_relax=False


③ Run AlphaFold 2 Mumtimer


#export TF_FORCE_UNIFIED_MEMORY=1           ## for GPU
#export XLA_PYTHON_CLIENT_PREALLOCATE=false ## for GPU
#export XLA_PYTHON_CLIENT_MEM_FRACTION=.85  ## for GPU

export JAX_PLATFORM_NAME=cpu                ## for CPU
export JAX_TRACEBACK_FILTERING=off          ## for CPU

python3 /app/alphafold/run_alphafold.py \
  --fasta_paths=/app/alphafold/data/data.fa \
  --output_dir=/mnt/output \
  --data_dir=/app/alphafold/scripts \
  --model_preset=multimer \
  --db_preset=reduced_dbs \
  --uniref90_database_path=/app/alphafold/scripts/uniref90/uniref90.fasta \
  --mgnify_database_path=/app/alphafold/scripts/mgnify/mgy_clusters_2022_05.fa \
  --small_bfd_database_path=/app/alphafold/scripts/small_bfd/bfd-first_non_consensus_sequences.fasta \
  --template_mmcif_dir=/app/alphafold/scripts/pdb_mmcif/mmcif_files \
  --obsolete_pdbs_path=/app/alphafold/scripts/pdb_mmcif/obsolete.dat \
  --pdb_seqres_database_path=/app/alphafold/scripts/pdb_seqres/pdb_seqres.txt \
  --uniprot_database_path=/app/alphafold/scripts/uniprot/uniprot.fasta \
  --max_template_date=1900-01-01 \
  --use_gpu_relax=False


Biopolymer Library



4. Spectroscopy

⑴ Overview

① Research on predicting MS, IR, and NMR spectra from chemical formulas or predicting chemical formulas from MS, IR, and NMR data is actively being conducted.

② This research is making significant progress with the advancement of deep learning technology.

○ Example: NMR-TS



**5. Reaction Mechanism

⑴ Recently, several AI companies—including Chemical.AI—have announced AI systems capable of reconstructing organic chemical reactions.


image



Input : 2023.11.30 02:40

results matching ""

    No results matching ""